CAS 1179643-30-1 appears in our catalog under these names: (4-(2,2-Difluoroethoxy)-5-methoxy-2-nitrophenyl)methanol, 95%, (4-(2,2-Difluoroethoxy)-5-methoxy-2-nitrophenyl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[4-(2,2-difluoroethoxy)-5-methoxy-2-nitrophenyl]methanol (CAS 1179643-30-1) is a chemical compound with the molecular formula C10H11F2NO5 and a molecular weight of 263.19 g/mol. IUPAC name: [4-(2,2-difluoroethoxy)-5-methoxy-2-nitrophenyl]methanol. InChIKey: GRZXZYHUDCKDSP-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO5 |
|---|---|
| Molecular weight | 263.19 g/mol |
| IUPAC name | [4-(2,2-difluoroethoxy)-5-methoxy-2-nitrophenyl]methanol |
| InChIKey | GRZXZYHUDCKDSP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CO)[N+](=O)[O-])OCC(F)F |
Computed by PubChem (NCBI)