CAS 117976-12-2 appears in our catalog under these names: Sodium 2–acetamidomalonate, Sodium 2-acetamidomalonate, 98%, 2-Acetamidomalonate (sodium), 98.0%, disodium 2-acetamidopropanedioate, 98%, 98%. Offered by: GLPBio, AmBeed, MedChemExpress, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 250 mg, 1 g, 500 mg.
Disodium;2-acetamidopropanedioate (CAS 117976-12-2) is a chemical compound with the molecular formula C5H5NNa2O5 and a molecular weight of 205.08 g/mol. IUPAC name: disodium;2-acetamidopropanedioate. InChIKey: DZHMKRWQGAVIJB-UHFFFAOYSA-L.
| Molecular formula | C5H5NNa2O5 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | disodium;2-acetamidopropanedioate |
| InChIKey | DZHMKRWQGAVIJB-UHFFFAOYSA-L |
| SMILES | CC(=O)NC(C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)