CAS 1179857-56-7 is the registry number for 3-Hydroxy-4-(6-nitro-1H-indazol-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(6-nitroindazol-1-yl)-1,1-dioxothiolan-3-ol (CAS 1179857-56-7) is a chemical compound with the molecular formula C11H11N3O5S and a molecular weight of 297.29 g/mol. IUPAC name: 4-(6-nitroindazol-1-yl)-1,1-dioxothiolan-3-ol. InChIKey: DLNPPODEPZEEAX-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O5S |
|---|---|
| Molecular weight | 297.29 g/mol |
| IUPAC name | 4-(6-nitroindazol-1-yl)-1,1-dioxothiolan-3-ol |
| InChIKey | DLNPPODEPZEEAX-UHFFFAOYSA-N |
| SMILES | C1C(C(CS1(=O)=O)O)N2C3=C(C=CC(=C3)[N+](=O)[O-])C=N2 |
Computed by PubChem (NCBI)