Products 1179913-22-4
CAS 1179913-22-4 is the registry number for 1-(3-fluorophenyl)-2,2-dimethylpropan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-fluorophenyl)-2,2-dimethylpropan-1-ol (CAS 1179913-22-4) is a chemical compound with the molecular formula C11H15FO and a molecular weight of 182.23 g/mol. IUPAC name: 1-(3-fluorophenyl)-2,2-dimethylpropan-1-ol. InChIKey: FSSUTHSVCHDTCG-UHFFFAOYSA-N.
| Molecular formula | C11H15FO |
|---|---|
| Molecular weight | 182.23 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-2,2-dimethylpropan-1-ol |
| InChIKey | FSSUTHSVCHDTCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC(=CC=C1)F)O |
Computed by PubChem (NCBI)