CAS 1179919-66-4 appears in our catalog under these names: 1-(4-Chlorophenyl)-5-phenylpentan-2-one, 1-(4-Chlorophenyl)-5-phenylpentan-2-one, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
1-(4-chlorophenyl)-5-phenylpentan-2-one (CAS 1179919-66-4) is a chemical compound with the molecular formula C17H17ClO and a molecular weight of 272.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-phenylpentan-2-one. InChIKey: ZAFZDRLDILIFJF-UHFFFAOYSA-N.
| Molecular formula | C17H17ClO |
|---|---|
| Molecular weight | 272.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-phenylpentan-2-one |
| InChIKey | ZAFZDRLDILIFJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC(=O)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)