CAS 1180-46-7 is the registry number for 4',5,6,7-Tetrahydroxyflavone tetraacetate. Offered by: Biosynth. Available pack sizes: 1g, 0,1g, 0,25g, 0,5g, 2g.
[4-(5,6,7-triacetyloxy-4-oxochromen-2-yl)phenyl] acetate (CAS 1180-46-7) is a chemical compound with the molecular formula C23H18O10 and a molecular weight of 454.4 g/mol. IUPAC name: [4-(5,6,7-triacetyloxy-4-oxochromen-2-yl)phenyl] acetate. InChIKey: SRVJEQWEVJCHCF-UHFFFAOYSA-N.
| Molecular formula | C23H18O10 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | [4-(5,6,7-triacetyloxy-4-oxochromen-2-yl)phenyl] acetate |
| InChIKey | SRVJEQWEVJCHCF-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)