Products 118000-57-0
CAS 118000-57-0 is the registry number for 6-Nitro-2-(4-nitrophenyl)imidazo[1,2-a]pyridine, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 10g.
6-nitro-2-(4-nitrophenyl)imidazo[1,2-a]pyridine (CAS 118000-57-0) is a chemical compound with the molecular formula C13H8N4O4 and a molecular weight of 284.23 g/mol. IUPAC name: 6-nitro-2-(4-nitrophenyl)imidazo[1,2-a]pyridine. InChIKey: FZIBIOFNSKXAJW-UHFFFAOYSA-N.
| Molecular formula | C13H8N4O4 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | 6-nitro-2-(4-nitrophenyl)imidazo[1,2-a]pyridine |
| InChIKey | FZIBIOFNSKXAJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C=C(C=CC3=N2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)