Products 118006-14-7
CAS 118006-14-7 is the registry number for DDN. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-acetyloxy-6,7-dichloro-5,8-dioxonaphthalen-1-yl) acetate (CAS 118006-14-7) is a chemical compound with the molecular formula C14H8Cl2O6 and a molecular weight of 343.1 g/mol. IUPAC name: (4-acetyloxy-6,7-dichloro-5,8-dioxonaphthalen-1-yl) acetate. InChIKey: QIJKSJNUTOPANC-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2O6 |
|---|---|
| Molecular weight | 343.1 g/mol |
| IUPAC name | (4-acetyloxy-6,7-dichloro-5,8-dioxonaphthalen-1-yl) acetate |
| InChIKey | QIJKSJNUTOPANC-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C2C(=C(C=C1)OC(=O)C)C(=O)C(=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
DDN, orb2945106