CAS 118020-46-5 is the registry number for Fructose Glycerol Derivative 7. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-1,5,6-trihydroxyhexane-2,3-dione (CAS 118020-46-5) is a chemical compound with the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. IUPAC name: (5R)-1,5,6-trihydroxyhexane-2,3-dione. InChIKey: OKVIFNQBEGMUGM-SCSAIBSYSA-N.
| Molecular formula | C6H10O5 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | (5R)-1,5,6-trihydroxyhexane-2,3-dione |
| InChIKey | OKVIFNQBEGMUGM-SCSAIBSYSA-N |
| SMILES | C([C@H](CO)O)C(=O)C(=O)CO |
Computed by PubChem (NCBI)