CAS 1180497-45-3 appears in our catalog under these names: 2-Amino-3-fluoro-4-methoxybenzoic acid, 2-Amino-3-fluoro-4-methoxybenzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,25g, 0,1g, 0,5g, 2g, 1g, 250mg.
2-amino-3-fluoro-4-methoxybenzoic acid (CAS 1180497-45-3) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 2-amino-3-fluoro-4-methoxybenzoic acid. InChIKey: PBKUCGDCMIJIFL-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-amino-3-fluoro-4-methoxybenzoic acid |
| InChIKey | PBKUCGDCMIJIFL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)O)N)F |
Computed by PubChem (NCBI)