Products 118054-52-7

CAS 118054-52-7 is the registry number for Zoledronic acid Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[1-hydroxy-2-(2-methylimidazol-1-yl)-1-phosphonoethyl]phosphonic acid (CAS 118054-52-7) is a chemical compound with the molecular formula C6H12N2O7P2 and a molecular weight of 286.12 g/mol. IUPAC name: [1-hydroxy-2-(2-methylimidazol-1-yl)-1-phosphonoethyl]phosphonic acid. InChIKey: AQHSXXBYJSGKFY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12N2O7P2
Molecular weight286.12 g/mol
IUPAC name[1-hydroxy-2-(2-methylimidazol-1-yl)-1-phosphonoethyl]phosphonic acid
InChIKeyAQHSXXBYJSGKFY-UHFFFAOYSA-N
SMILESCC1=NC=CN1CC(O)(P(=O)(O)O)P(=O)(O)O

Computed by PubChem (NCBI)