CAS 1180675-98-2 appears in our catalog under these names: 3-Bromo-5-(pentafluorosulfur)benzoic acid, 95%, 3-Bromo-5-(pentafluorosulfur)benzoic Acid, 3-Bromo-5-(pentafluorosulfur)benzoic acid, 95%, 95%. Offered by: Combi-blocks, TRC, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-bromo-5-(pentafluoro-lambda6-sulfanyl)benzoic acid (CAS 1180675-98-2) is a chemical compound with the molecular formula C7H4BrF5O2S and a molecular weight of 327.07 g/mol. IUPAC name: 3-bromo-5-(pentafluoro-lambda6-sulfanyl)benzoic acid. InChIKey: GGDWTFSLWQRHPR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF5O2S |
|---|---|
| Molecular weight | 327.07 g/mol |
| IUPAC name | 3-bromo-5-(pentafluoro-lambda6-sulfanyl)benzoic acid |
| InChIKey | GGDWTFSLWQRHPR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(F)(F)(F)(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)