CAS 1180676-32-7 appears in our catalog under these names: Ps48, 95%, PS 48/ 98%, PS 48, PS 48, PS-48 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 10mg, 5mg, 50mg, 25mg, 100mg, 10mM (in 1ml dmso), 250mg, 5 mg.
(Z)-5-(4-chlorophenyl)-3-phenylpent-2-enoic acid (CAS 1180676-32-7) is a chemical compound with the molecular formula C17H15ClO2 and a molecular weight of 286.8 g/mol. IUPAC name: (Z)-5-(4-chlorophenyl)-3-phenylpent-2-enoic acid. InChIKey: LLJYFDRQFPQGNY-QINSGFPZSA-N.
| Molecular formula | C17H15ClO2 |
|---|---|
| Molecular weight | 286.8 g/mol |
| IUPAC name | (Z)-5-(4-chlorophenyl)-3-phenylpent-2-enoic acid |
| InChIKey | LLJYFDRQFPQGNY-QINSGFPZSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C\C(=O)O)/CCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)