CAS 118068-28-3 is the registry number for 2-Hydroxy-1,2,3-propanetricarboxylic Acid 1-Butyl Ester. Offered by: TRC. Available pack sizes: 250mg.
2-(2-butoxy-2-oxoethyl)-2-hydroxybutanedioate (CAS 118068-28-3) is a chemical compound with the molecular formula C10H14O7-2 and a molecular weight of 246.21 g/mol. IUPAC name: 2-(2-butoxy-2-oxoethyl)-2-hydroxybutanedioate. InChIKey: TWUZWTIVCCRAAD-UHFFFAOYSA-L.
| Molecular formula | C10H14O7-2 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 2-(2-butoxy-2-oxoethyl)-2-hydroxybutanedioate |
| InChIKey | TWUZWTIVCCRAAD-UHFFFAOYSA-L |
| SMILES | CCCCOC(=O)CC(CC(=O)[O-])(C(=O)[O-])O |
Computed by PubChem (NCBI)