Products 118077-46-6

CAS 118077-46-6 is the registry number for 6,6'-Disulfanediyldihexan-1-amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

6-(6-aminohexyldisulfanyl)hexan-1-amine;dihydrochloride (CAS 118077-46-6) is a chemical compound with the molecular formula C12H30Cl2N2S2 and a molecular weight of 337.4 g/mol. IUPAC name: 6-(6-aminohexyldisulfanyl)hexan-1-amine;dihydrochloride. InChIKey: RVCHLIAUCZTPNS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H30Cl2N2S2
Molecular weight337.4 g/mol
IUPAC name6-(6-aminohexyldisulfanyl)hexan-1-amine;dihydrochloride
InChIKeyRVCHLIAUCZTPNS-UHFFFAOYSA-N
SMILESC(CCCSSCCCCCCN)CCN.Cl.Cl

Computed by PubChem (NCBI)