CAS 118080-95-8 is the registry number for Diethyl Phosphonate-d10. Offered by: TRC. Available pack sizes: 25mg.
Oxo-bis(1,1,2,2,2-pentadeuterioethoxy)phosphanium (CAS 118080-95-8) is a chemical compound with the molecular formula C4H10O3P+ and a molecular weight of 147.16 g/mol. IUPAC name: oxo-bis(1,1,2,2,2-pentadeuterioethoxy)phosphanium. InChIKey: LXCYSACZTOKNNS-MWUKXHIBSA-N.
| Molecular formula | C4H10O3P+ |
|---|---|
| Molecular weight | 147.16 g/mol |
| IUPAC name | oxo-bis(1,1,2,2,2-pentadeuterioethoxy)phosphanium |
| InChIKey | LXCYSACZTOKNNS-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])O[P+](=O)OC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)