CAS 1181404-71-6 is the registry number for 2-Hydroxy-3-(3-methylphenyl)propanoic acid, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-hydroxy-3-(3-methylphenyl)propanoic acid (CAS 1181404-71-6) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-hydroxy-3-(3-methylphenyl)propanoic acid. InChIKey: PVAQRTBQTOOWOQ-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-hydroxy-3-(3-methylphenyl)propanoic acid |
| InChIKey | PVAQRTBQTOOWOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CC(C(=O)O)O |
Computed by PubChem (NCBI)