CAS 1181458-00-3 is the registry number for 4-({((3-fluorophenyl)methyl)amino}methyl)benzonitrile hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[[(3-fluorophenyl)methylamino]methyl]benzonitrile;hydrochloride (CAS 1181458-00-3) is a chemical compound with the molecular formula C15H14ClFN2 and a molecular weight of 276.73 g/mol. IUPAC name: 4-[[(3-fluorophenyl)methylamino]methyl]benzonitrile;hydrochloride. InChIKey: SALORYYEKCEIAS-UHFFFAOYSA-N.
| Molecular formula | C15H14ClFN2 |
|---|---|
| Molecular weight | 276.73 g/mol |
| IUPAC name | 4-[[(3-fluorophenyl)methylamino]methyl]benzonitrile;hydrochloride |
| InChIKey | SALORYYEKCEIAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CNCC2=CC=C(C=C2)C#N.Cl |
Computed by PubChem (NCBI)