CAS 1181458-09-2 appears in our catalog under these names: 2-[(5-Chloro-7-iodoquinolin-8-yl)oxy]propanoic acid hydrochloride, 95%, 2-((5-Chloro-7-iodoquinolin-8-yl)oxy)propanoic acid hydrochloride, 95%, 2-((5-Chloro-7-iodoquinolin-8-yl)oxy)propanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(5-chloro-7-iodoquinolin-8-yl)oxypropanoic acid;hydrochloride (CAS 1181458-09-2) is a chemical compound with the molecular formula C12H10Cl2INO3 and a molecular weight of 414.02 g/mol. IUPAC name: 2-(5-chloro-7-iodoquinolin-8-yl)oxypropanoic acid;hydrochloride. InChIKey: YYMMTGDRGAWQID-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2INO3 |
|---|---|
| Molecular weight | 414.02 g/mol |
| IUPAC name | 2-(5-chloro-7-iodoquinolin-8-yl)oxypropanoic acid;hydrochloride |
| InChIKey | YYMMTGDRGAWQID-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=C(C=C(C2=C1N=CC=C2)Cl)I.Cl |
Computed by PubChem (NCBI)