CAS 1181458-13-8 appears in our catalog under these names: Sodium (4-oxo-3,4-dihydroquinazolin-2-yl)methanesulfonate, 95%, Sodium (4-oxo-3,4-dihydroquinazolin-2-yl)methanesulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
Sodium (4-oxo-3H-quinazolin-2-yl)methanesulfonate (CAS 1181458-13-8) is a chemical compound with the molecular formula C9H7N2NaO4S and a molecular weight of 262.22 g/mol. IUPAC name: sodium (4-oxo-3H-quinazolin-2-yl)methanesulfonate. InChIKey: HXKDWHDMVPALBY-UHFFFAOYSA-M.
| Molecular formula | C9H7N2NaO4S |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | sodium (4-oxo-3H-quinazolin-2-yl)methanesulfonate |
| InChIKey | HXKDWHDMVPALBY-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)CS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)