Products 1181458-21-8

CAS 1181458-21-8 is the registry number for 4-Bromo-2-methoxy-6-methylaniline hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

4-bromo-2-methoxy-6-methylaniline;hydrobromide (CAS 1181458-21-8) is a chemical compound with the molecular formula C8H11Br2NO and a molecular weight of 296.99 g/mol. IUPAC name: 4-bromo-2-methoxy-6-methylaniline;hydrobromide. InChIKey: DTNOLXONFSKXMU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11Br2NO
Molecular weight296.99 g/mol
IUPAC name4-bromo-2-methoxy-6-methylaniline;hydrobromide
InChIKeyDTNOLXONFSKXMU-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1N)OC)Br.Br

Computed by PubChem (NCBI)