CAS 1181458-28-5 is the registry number for 1-(4-(Trifluoromethoxy)benzenesulfonyl)piperazine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine;hydrochloride (CAS 1181458-28-5) is a chemical compound with the molecular formula C11H14ClF3N2O3S and a molecular weight of 346.75 g/mol. IUPAC name: 1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine;hydrochloride. InChIKey: NSFPNCRFKPYQHV-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF3N2O3S |
|---|---|
| Molecular weight | 346.75 g/mol |
| IUPAC name | 1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine;hydrochloride |
| InChIKey | NSFPNCRFKPYQHV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=C(C=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)