CAS 1181458-74-1 appears in our catalog under these names: 4-Methyl-5-((4-methylphenyl)methyl)-1,3-thiazol-2-amine hydrobromide, 95%, 4-Methyl-5-((4-methylphenyl)methyl)-1,3-thiazol-2-amine hydrobromide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
4-methyl-5-[(4-methylphenyl)methyl]-1,3-thiazol-2-amine;hydrobromide (CAS 1181458-74-1) is a chemical compound with the molecular formula C12H15BrN2S and a molecular weight of 299.23 g/mol. IUPAC name: 4-methyl-5-[(4-methylphenyl)methyl]-1,3-thiazol-2-amine;hydrobromide. InChIKey: UWBJOARDXOYVJH-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2S |
|---|---|
| Molecular weight | 299.23 g/mol |
| IUPAC name | 4-methyl-5-[(4-methylphenyl)methyl]-1,3-thiazol-2-amine;hydrobromide |
| InChIKey | UWBJOARDXOYVJH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC2=C(N=C(S2)N)C.Br |
Computed by PubChem (NCBI)