CAS 1181460-51-4 is the registry number for N-Isobutyl-3-(1,3,5-trimethyl-1H-pyrazol-4-yl)acrylamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-N-(2-methylpropyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide (CAS 1181460-51-4) is a chemical compound with the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. IUPAC name: (E)-N-(2-methylpropyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide. InChIKey: IOEMADUXCSKXKG-VOTSOKGWSA-N.
| Molecular formula | C13H21N3O |
|---|---|
| Molecular weight | 235.33 g/mol |
| IUPAC name | (E)-N-(2-methylpropyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
| InChIKey | IOEMADUXCSKXKG-VOTSOKGWSA-N |
| SMILES | CC1=C(C(=NN1C)C)/C=C/C(=O)NCC(C)C |
Computed by PubChem (NCBI)