CAS 1181522-20-2 is the registry number for 1-N-(1,3-Benzothiazol-2-yl)benzene-1,3-diamine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-N-(1,3-benzothiazol-2-yl)benzene-1,3-diamine;dihydrochloride (CAS 1181522-20-2) is a chemical compound with the molecular formula C13H13Cl2N3S and a molecular weight of 314.2 g/mol. IUPAC name: 3-N-(1,3-benzothiazol-2-yl)benzene-1,3-diamine;dihydrochloride. InChIKey: MVCYADBAPWEWRZ-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N3S |
|---|---|
| Molecular weight | 314.2 g/mol |
| IUPAC name | 3-N-(1,3-benzothiazol-2-yl)benzene-1,3-diamine;dihydrochloride |
| InChIKey | MVCYADBAPWEWRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NC3=CC=CC(=C3)N.Cl.Cl |
Computed by PubChem (NCBI)