CAS 118159-52-7 is the registry number for 2,6-Dichloro-3-fluoro-4-nitrophenol, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2,6-dichloro-3-fluoro-4-nitrophenol (CAS 118159-52-7) is a chemical compound with the molecular formula C6H2Cl2FNO3 and a molecular weight of 225.99 g/mol. IUPAC name: 2,6-dichloro-3-fluoro-4-nitrophenol. InChIKey: NOVREVWBDYSQLX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO3 |
|---|---|
| Molecular weight | 225.99 g/mol |
| IUPAC name | 2,6-dichloro-3-fluoro-4-nitrophenol |
| InChIKey | NOVREVWBDYSQLX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)O)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)