Products 118162-46-2
CAS 118162-46-2 appears in our catalog under these names: 15–Azido–pentadecanoic acid, Azido palmitic acid, 15-Azido-pentadecanoic acid, 99.88%, 15-Azido-pentadecanoic acid, 99%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 2mg, 1mg, 5mg, 50 mg, 5 mg.
15-azidopentadecanoic acid (CAS 118162-46-2) is a chemical compound with the molecular formula C15H29N3O2 and a molecular weight of 283.41 g/mol. IUPAC name: 15-azidopentadecanoic acid. InChIKey: PYGQAGHMXCCROO-UHFFFAOYSA-N.
| Molecular formula | C15H29N3O2 |
|---|---|
| Molecular weight | 283.41 g/mol |
| IUPAC name | 15-azidopentadecanoic acid |
| InChIKey | PYGQAGHMXCCROO-UHFFFAOYSA-N |
| SMILES | C(CCCCCCCN=[N+]=[N-])CCCCCCC(=O)O |
Computed by PubChem (NCBI)