Products 1181818-12-1
CAS 1181818-12-1 is the registry number for (S)-5-(3,5-Difluorophenyl)pyrrolidin-2-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
(5S)-5-(3,5-difluorophenyl)pyrrolidin-2-one (CAS 1181818-12-1) is a chemical compound with the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. IUPAC name: (5S)-5-(3,5-difluorophenyl)pyrrolidin-2-one. InChIKey: OWGSUNHQOOOHBW-VIFPVBQESA-N.
| Molecular formula | C10H9F2NO |
|---|---|
| Molecular weight | 197.18 g/mol |
| IUPAC name | (5S)-5-(3,5-difluorophenyl)pyrrolidin-2-one |
| InChIKey | OWGSUNHQOOOHBW-VIFPVBQESA-N |
| SMILES | C1CC(=O)N[C@@H]1C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)