CAS 1181826-14-1 appears in our catalog under these names: 1-tert-Butyl-4,5,6,7-tetrahydro-1H-indazol-4-amine, 95%, 1-tert-Butyl-4,5,6,7-tetrahydro-1H-indazol-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 50mg, 250mg, 1000mg, 500mg.
1-tert-butyl-4,5,6,7-tetrahydroindazol-4-amine (CAS 1181826-14-1) is a chemical compound with the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. IUPAC name: 1-tert-butyl-4,5,6,7-tetrahydroindazol-4-amine. InChIKey: CNIAQZASAMBYNA-UHFFFAOYSA-N.
| Molecular formula | C11H19N3 |
|---|---|
| Molecular weight | 193.29 g/mol |
| IUPAC name | 1-tert-butyl-4,5,6,7-tetrahydroindazol-4-amine |
| InChIKey | CNIAQZASAMBYNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=C(C=N1)C(CCC2)N |
Computed by PubChem (NCBI)