CAS 1182011-65-9 is the registry number for AR Degrader-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzamide (CAS 1182011-65-9) is a chemical compound with the molecular formula C23H21N3O4S and a molecular weight of 435.5 g/mol. IUPAC name: 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzamide. InChIKey: QQDVQSAQUAHWDB-UHFFFAOYSA-N.
| Molecular formula | C23H21N3O4S |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzamide |
| InChIKey | QQDVQSAQUAHWDB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)COC2=CC=C(C=C2)C(=O)NC3=NC(=CS3)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)