Products 1182037-78-0
CAS 1182037-78-0 appears in our catalog under these names: NEpsilon,NEpsilon,NEpsilon-Trimethyllysine-d9, Trimethyllysine–d9, Trimethyllysine-d9, 95.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 1mg, 5mg, 2.5 mg.
(2S)-2-amino-6-[tris(trideuteriomethyl)azaniumyl]hexanoate (CAS 1182037-78-0) is a chemical compound with the molecular formula C9H20N2O2 and a molecular weight of 197.32 g/mol. IUPAC name: (2S)-2-amino-6-[tris(trideuteriomethyl)azaniumyl]hexanoate. InChIKey: MXNRLFUSFKVQSK-DQBSYZJZSA-N.
| Molecular formula | C9H20N2O2 |
|---|---|
| Molecular weight | 197.32 g/mol |
| IUPAC name | (2S)-2-amino-6-[tris(trideuteriomethyl)azaniumyl]hexanoate |
| InChIKey | MXNRLFUSFKVQSK-DQBSYZJZSA-N |
| SMILES | [2H]C([2H])([2H])[N+](CCCC[C@@H](C(=O)[O-])N)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)