Products 1182349-49-0
CAS 1182349-49-0 appears in our catalog under these names: 1-(1-Benzylpiperidin-3-yl)-2,2,2-trifluoroethanone, 95%, 1-(1-Benzylpiperidin-3-yl)-2,2,2-trifluoroethanone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 500mg, 1g, 5g.
1-(1-benzylpiperidin-3-yl)-2,2,2-trifluoroethanone (CAS 1182349-49-0) is a chemical compound with the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. IUPAC name: 1-(1-benzylpiperidin-3-yl)-2,2,2-trifluoroethanone. InChIKey: GAYNMYZCQZOPDY-UHFFFAOYSA-N.
| Molecular formula | C14H16F3NO |
|---|---|
| Molecular weight | 271.28 g/mol |
| IUPAC name | 1-(1-benzylpiperidin-3-yl)-2,2,2-trifluoroethanone |
| InChIKey | GAYNMYZCQZOPDY-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)