Products 118252-44-1
CAS 118252-44-1 is the registry number for 5-DACTHF. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylamino]benzoyl]amino]pentanedioic acid (CAS 118252-44-1) is a chemical compound with the molecular formula C19H24N6O6 and a molecular weight of 432.4 g/mol. IUPAC name: (2S)-2-[[4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylamino]benzoyl]amino]pentanedioic acid. InChIKey: CPVRCGLCOADOPV-ZDUSSCGKSA-N.
| Molecular formula | C19H24N6O6 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | (2S)-2-[[4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)propylamino]benzoyl]amino]pentanedioic acid |
| InChIKey | CPVRCGLCOADOPV-ZDUSSCGKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCCCC2=C(N=C(NC2=O)N)N |
Computed by PubChem (NCBI)