CAS 1182728-20-6 appears in our catalog under these names: Benzyl(3-bromo-2-chlorophenyl)sulfane, 95%, Benzyl(3–bromo–2–chlorophenyl)sulfane. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
1-benzylsulfanyl-3-bromo-2-chlorobenzene (CAS 1182728-20-6) is a chemical compound with the molecular formula C13H10BrClS and a molecular weight of 313.64 g/mol. IUPAC name: 1-benzylsulfanyl-3-bromo-2-chlorobenzene. InChIKey: DLDCTARMJSNVAG-UHFFFAOYSA-N.
| Molecular formula | C13H10BrClS |
|---|---|
| Molecular weight | 313.64 g/mol |
| IUPAC name | 1-benzylsulfanyl-3-bromo-2-chlorobenzene |
| InChIKey | DLDCTARMJSNVAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=C(C(=CC=C2)Br)Cl |
Computed by PubChem (NCBI)