Products 118286-67-2
CAS 118286-67-2 is the registry number for 2-Chloro-α-phenyl-5-(trifluoromethyl)benzenemethanol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[2-chloro-5-(trifluoromethyl)phenyl]-phenylmethanol (CAS 118286-67-2) is a chemical compound with the molecular formula C14H10ClF3O and a molecular weight of 286.67 g/mol. IUPAC name: [2-chloro-5-(trifluoromethyl)phenyl]-phenylmethanol. InChIKey: WHRSQPNAIQNKGN-UHFFFAOYSA-N.
| Molecular formula | C14H10ClF3O |
|---|---|
| Molecular weight | 286.67 g/mol |
| IUPAC name | [2-chloro-5-(trifluoromethyl)phenyl]-phenylmethanol |
| InChIKey | WHRSQPNAIQNKGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C=CC(=C2)C(F)(F)F)Cl)O |
Computed by PubChem (NCBI)