CAS 118288-14-5 appears in our catalog under these names: Lafutidine Impurity 14, Lafutidine Impurity 5, 2-((Furan-2-ylmethyl)sulfinyl)-N-(4-((4-(piperidin-1-ylmethyl)pyridin-2-yl)oxy)butyl)acetamide, 98%, Lafutidine Dihydro Impurity, Dihydro Lafutidine, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(furan-2-ylmethylsulfinyl)-N-[4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]butyl]acetamide (CAS 118288-14-5) is a chemical compound with the molecular formula C22H31N3O4S and a molecular weight of 433.6 g/mol. IUPAC name: 2-(furan-2-ylmethylsulfinyl)-N-[4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]butyl]acetamide. InChIKey: OXNROJCVYGRYJB-UHFFFAOYSA-N.
| Molecular formula | C22H31N3O4S |
|---|---|
| Molecular weight | 433.6 g/mol |
| IUPAC name | 2-(furan-2-ylmethylsulfinyl)-N-[4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]butyl]acetamide |
| InChIKey | OXNROJCVYGRYJB-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=CC(=NC=C2)OCCCCNC(=O)CS(=O)CC3=CC=CO3 |
Computed by PubChem (NCBI)