CAS 1183082-06-5 is the registry number for 1-(2-Methoxyethyl)-1H-pyrazole-4-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2-methoxyethyl)pyrazole-4-sulfonyl chloride (CAS 1183082-06-5) is a chemical compound with the molecular formula C6H9ClN2O3S and a molecular weight of 224.67 g/mol. IUPAC name: 1-(2-methoxyethyl)pyrazole-4-sulfonyl chloride. InChIKey: DQABRQGINUJMAQ-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O3S |
|---|---|
| Molecular weight | 224.67 g/mol |
| IUPAC name | 1-(2-methoxyethyl)pyrazole-4-sulfonyl chloride |
| InChIKey | DQABRQGINUJMAQ-UHFFFAOYSA-N |
| SMILES | COCCN1C=C(C=N1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)