Products 1183082-06-5

CAS 1183082-06-5 is the registry number for 1-(2-Methoxyethyl)-1H-pyrazole-4-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

1-(2-methoxyethyl)pyrazole-4-sulfonyl chloride (CAS 1183082-06-5) is a chemical compound with the molecular formula C6H9ClN2O3S and a molecular weight of 224.67 g/mol. IUPAC name: 1-(2-methoxyethyl)pyrazole-4-sulfonyl chloride. InChIKey: DQABRQGINUJMAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClN2O3S
Molecular weight224.67 g/mol
IUPAC name1-(2-methoxyethyl)pyrazole-4-sulfonyl chloride
InChIKeyDQABRQGINUJMAQ-UHFFFAOYSA-N
SMILESCOCCN1C=C(C=N1)S(=O)(=O)Cl

Computed by PubChem (NCBI)