CAS 1183315-30-1 is the registry number for 6-Chloro-N,N-dimethylpyridazine-3-carboxamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-chloro-N,N-dimethylpyridazine-3-carboxamide (CAS 1183315-30-1) is a chemical compound with the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. IUPAC name: 6-chloro-N,N-dimethylpyridazine-3-carboxamide. InChIKey: GWMVZQMITYLUFP-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 6-chloro-N,N-dimethylpyridazine-3-carboxamide |
| InChIKey | GWMVZQMITYLUFP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=NN=C(C=C1)Cl |
Computed by PubChem (NCBI)