Products 1183358-09-9
CAS 1183358-09-9 is the registry number for 2-Fluoro-N-(1-methyl-3-pyrazolyl)-5-nitrobenzamide, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
2-fluoro-N-(1-methylpyrazol-3-yl)-5-nitrobenzamide (CAS 1183358-09-9) is a chemical compound with the molecular formula C11H9FN4O3 and a molecular weight of 264.21 g/mol. IUPAC name: 2-fluoro-N-(1-methylpyrazol-3-yl)-5-nitrobenzamide. InChIKey: DSORJWGYUZIJHR-UHFFFAOYSA-N.
| Molecular formula | C11H9FN4O3 |
|---|---|
| Molecular weight | 264.21 g/mol |
| IUPAC name | 2-fluoro-N-(1-methylpyrazol-3-yl)-5-nitrobenzamide |
| InChIKey | DSORJWGYUZIJHR-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)NC(=O)C2=C(C=CC(=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)