CAS 1183375-09-8 is the registry number for 4-Bromo-1-{5-methyl-(1,2,4)triazolo(1,5-a)pyrimidin-7-yl}-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-(4-bromopyrazol-1-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 1183375-09-8) is a chemical compound with the molecular formula C9H7BrN6 and a molecular weight of 279.10 g/mol. IUPAC name: 7-(4-bromopyrazol-1-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: RWLJEWDQKGQCLG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN6 |
|---|---|
| Molecular weight | 279.10 g/mol |
| IUPAC name | 7-(4-bromopyrazol-1-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | RWLJEWDQKGQCLG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC=NN2C(=C1)N3C=C(C=N3)Br |
Computed by PubChem (NCBI)