CAS 1183422-13-0 is the registry number for 3-Fluoro-4'-(propan-2-yloxy)-(1,1'-biphenyl)-4-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-fluoro-4-(4-propan-2-yloxyphenyl)aniline (CAS 1183422-13-0) is a chemical compound with the molecular formula C15H16FNO and a molecular weight of 245.29 g/mol. IUPAC name: 2-fluoro-4-(4-propan-2-yloxyphenyl)aniline. InChIKey: BIKHPGNTQYXMEU-UHFFFAOYSA-N.
| Molecular formula | C15H16FNO |
|---|---|
| Molecular weight | 245.29 g/mol |
| IUPAC name | 2-fluoro-4-(4-propan-2-yloxyphenyl)aniline |
| InChIKey | BIKHPGNTQYXMEU-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C2=CC(=C(C=C2)N)F |
Computed by PubChem (NCBI)