CAS 1183493-44-8 is the registry number for 3-(3-Amino-1H-1,2,4-triazol-1-yl)tetrahydrothiophene 1,1-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(1,1-dioxothiolan-3-yl)-1,2,4-triazol-3-amine (CAS 1183493-44-8) is a chemical compound with the molecular formula C6H10N4O2S and a molecular weight of 202.24 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)-1,2,4-triazol-3-amine. InChIKey: PDFQWPNWGFUKPI-UHFFFAOYSA-N.
| Molecular formula | C6H10N4O2S |
|---|---|
| Molecular weight | 202.24 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)-1,2,4-triazol-3-amine |
| InChIKey | PDFQWPNWGFUKPI-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C=NC(=N2)N |
Computed by PubChem (NCBI)