CAS 1183511-02-5 is the registry number for 3-(4-Fluorobenzoyl)quinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4-fluorophenyl)-quinolin-3-ylmethanone (CAS 1183511-02-5) is a chemical compound with the molecular formula C16H10FNO and a molecular weight of 251.25 g/mol. IUPAC name: (4-fluorophenyl)-quinolin-3-ylmethanone. InChIKey: RTQPEKDTIMMPGS-UHFFFAOYSA-N.
| Molecular formula | C16H10FNO |
|---|---|
| Molecular weight | 251.25 g/mol |
| IUPAC name | (4-fluorophenyl)-quinolin-3-ylmethanone |
| InChIKey | RTQPEKDTIMMPGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)C(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)