CAS 1183525-04-3 is the registry number for 3-(4-Fluoro-2-nitrophenoxy)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(4-fluoro-2-nitrophenoxy)phenol (CAS 1183525-04-3) is a chemical compound with the molecular formula C12H8FNO4 and a molecular weight of 249.19 g/mol. IUPAC name: 3-(4-fluoro-2-nitrophenoxy)phenol. InChIKey: SWDCLESJGWEPNE-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO4 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | 3-(4-fluoro-2-nitrophenoxy)phenol |
| InChIKey | SWDCLESJGWEPNE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=C(C=C(C=C2)F)[N+](=O)[O-])O |
Computed by PubChem (NCBI)