CAS 118354-71-5 appears in our catalog under these names: (S)-1-Benzyl-3-mesyloxypyrrolidine, 95%, (S)-Pyrrolidin-3-yl 2-phenylethanesulfonate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
[(3S)-1-benzylpyrrolidin-3-yl] methanesulfonate (CAS 118354-71-5) is a chemical compound with the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. IUPAC name: [(3S)-1-benzylpyrrolidin-3-yl] methanesulfonate. InChIKey: NZIDTDIDEPGKHB-LBPRGKRZSA-N.
| Molecular formula | C12H17NO3S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | [(3S)-1-benzylpyrrolidin-3-yl] methanesulfonate |
| InChIKey | NZIDTDIDEPGKHB-LBPRGKRZSA-N |
| SMILES | CS(=O)(=O)O[C@H]1CCN(C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)