CAS 1183596-21-5 appears in our catalog under these names: 4-(3-(Aminomethyl)pentan-3-yl)-1,2-dichlorobenzene, 95%, 4-(3-(Aminomethyl)pentan-3-yl)-1,2-dichlorobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(3,4-dichlorophenyl)-2-ethylbutan-1-amine (CAS 1183596-21-5) is a chemical compound with the molecular formula C12H17Cl2N and a molecular weight of 246.17 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2-ethylbutan-1-amine. InChIKey: JZTBHJVBWOYXCN-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N |
|---|---|
| Molecular weight | 246.17 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2-ethylbutan-1-amine |
| InChIKey | JZTBHJVBWOYXCN-UHFFFAOYSA-N |
| SMILES | CCC(CC)(CN)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)