CAS 1183655-01-7 is the registry number for N-{4-((Dimethylamino)methyl)phenyl}-4-fluorobenzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-[4-[(dimethylamino)methyl]phenyl]-4-fluorobenzamide (CAS 1183655-01-7) is a chemical compound with the molecular formula C16H17FN2O and a molecular weight of 272.32 g/mol. IUPAC name: N-[4-[(dimethylamino)methyl]phenyl]-4-fluorobenzamide. InChIKey: SBPMPJSPUMQJFG-UHFFFAOYSA-N.
| Molecular formula | C16H17FN2O |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | N-[4-[(dimethylamino)methyl]phenyl]-4-fluorobenzamide |
| InChIKey | SBPMPJSPUMQJFG-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC=C(C=C1)NC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)