CAS 118375-95-4 appears in our catalog under these names: (S)-Methyl 2-(2-chloroacetamido) propanoate, 95%, (S)-Methyl 2-(2-chloroacetamido)propanoate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Methyl (2S)-2-[(2-chloroacetyl)amino]propanoate (CAS 118375-95-4) is a chemical compound with the molecular formula C6H10ClNO3 and a molecular weight of 179.60 g/mol. IUPAC name: methyl (2S)-2-[(2-chloroacetyl)amino]propanoate. InChIKey: JWNMQNKURMACSS-BYPYZUCNSA-N.
| Molecular formula | C6H10ClNO3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | methyl (2S)-2-[(2-chloroacetyl)amino]propanoate |
| InChIKey | JWNMQNKURMACSS-BYPYZUCNSA-N |
| SMILES | C[C@@H](C(=O)OC)NC(=O)CCl |
Computed by PubChem (NCBI)