CAS 1183785-49-0 appears in our catalog under these names: 4-((7-Chloroquinolin-4-yl)sulfanyl)phenol, 95%, 4-((7-Chloroquinolin-4-yl)sulfanyl)phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(7-chloroquinolin-4-yl)sulfanylphenol (CAS 1183785-49-0) is a chemical compound with the molecular formula C15H10ClNOS and a molecular weight of 287.8 g/mol. IUPAC name: 4-(7-chloroquinolin-4-yl)sulfanylphenol. InChIKey: LLPPRQSMHZRHOG-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNOS |
|---|---|
| Molecular weight | 287.8 g/mol |
| IUPAC name | 4-(7-chloroquinolin-4-yl)sulfanylphenol |
| InChIKey | LLPPRQSMHZRHOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)SC2=C3C=CC(=CC3=NC=C2)Cl |
Computed by PubChem (NCBI)