CAS 1183841-34-0 appears in our catalog under these names: N-(5-Bromo-1,3-thiazol-2-yl)-4-methoxybenzene-1-sulfonamide, 95%, N-(5-Bromo-1,3-thiazol-2-yl)-4-methoxybenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-(5-bromo-1,3-thiazol-2-yl)-4-methoxybenzenesulfonamide (CAS 1183841-34-0) is a chemical compound with the molecular formula C10H9BrN2O3S2 and a molecular weight of 349.2 g/mol. IUPAC name: N-(5-bromo-1,3-thiazol-2-yl)-4-methoxybenzenesulfonamide. InChIKey: RGFRUNCRFICABQ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O3S2 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | N-(5-bromo-1,3-thiazol-2-yl)-4-methoxybenzenesulfonamide |
| InChIKey | RGFRUNCRFICABQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=NC=C(S2)Br |
Computed by PubChem (NCBI)